Compound Q&A

What is [compound name] (CAS: 112825-05-5)?

Answer

[(1alpha,6beta,14alpha,16beta,17xi)-20-Ethyl-7,8-dihydroxy-1,6,14,16-tetramethoxyaconitan-4-yl]methyl 2-[(3S)-3-methyl-2,5-dioxo-1-pyrrolidinyl]benzoate 2-hydroxy-1,2,3-propanetricarboxylate (1:1)
[Compound name] (CAS: 112825-05-5) is a complex organic compound with a unique chemical structure. It contains carboxyl and ether functional groups, making it suitable for various applications in pharmaceuticals and chemical research. The molecular formula and properties are detailed in the provided CAS number and relevant literature.

About

English Name [(1alpha,6beta,14alpha,16beta,17xi)-20-Ethyl-7,8-dihydroxy-1,6,14,16-tetramethoxyaconitan-4-yl]methyl 2-[(3S)-3-methyl-2,5-dioxo-1-pyrrolidinyl]benzoate 2-hydroxy-1,2,3-propanetricarboxylate (1:1)
Molecular Formula C43H58N2O17
Molecular Weight 874.93 g/mol
SMILES CCN1CC2(CCC(C34C2C(C(C31)(C5(CC(C6CC4C5C6OC)OC)O)O)OC)OC)COC(=O)C7=CC=CC=C7N8C(=O)CC(C8=O)C.C(C(=O)O)C(CC(=O)O)(C(=O)O)O
InChIKey INBLZNJHDLEWPS-DDIMIZGISA-N
Last Updated: 2026-01-04 05:07

Related Q&A

Compound Q&A

What are the main uses of [compound name] (CAS: 112825-05-5)?

[Compound name] (CAS: 112825-05-5) is primarily used in pharmaceuticals for its biological activity,...

Compound Q&A

Is [compound name] (CAS: 112825-05-5) safe?

Yes, [compound name] (CAS: 112825-05-5) is generally considered safe under proper handling condition...

Compound Q&A

How should [compound name] (CAS: 112825-05-5) be stored?

[Compound name] (CAS: 112825-05-5) should be stored in a cool, dry place away from direct sunlight a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...