Compound Q&A

What industries use (2R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethyl-1-propanamine (CAS: 60-99-1)?

Answer

(2R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethyl-1-propanamine
This compound is primarily used in the pharmaceutical industry for its potential therapeutic applications, particularly in the development of antipsychotic drugs. It is also utilized in the polymer industry for its electronic properties and in the semiconductor industry for its role as a dopant. Additionally, it has applications in the production of sensors due to its ability to interact with certain analytes.

About

CAS No 60-99-1
English Name (2R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethyl-1-propanamine
Molecular Formula C19H24N2OS
Molecular Weight 328.48 g/mol
SMILES COc1ccc2Sc3ccccc3N(C[C@H](C)CN(C)C)c2c1
InChIKey VRQVVMDWGGWHTJ-CQSZACIVSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethyl-1-propanamine (CAS: 60-99-1)?

This compound is a crystalline solid with a molecular weight of approximately 319.4 g/mol. It has a ...

Compound Q&A

How is (2R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethyl-1-propanamine (CAS: 60-99-1) typically synthesized?

The compound is synthesized through a multi-step process involving the coupling of 2-methoxyphenothi...

Compound Q&A

What precautions should be taken when handling (2R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethyl-1-propanamine (CAS: 60-99-1)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...