Compound Q&A

How is (2R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethyl-1-propanamine (CAS: 60-99-1) typically synthesized?

Answer

(2R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethyl-1-propanamine
The compound is synthesized through a multi-step process involving the coupling of 2-methoxyphenothiazine with 2,2,3-trimethyl-1-propanamine. Commonly, the synthesis involves the use of a palladium catalyst in the presence of a base. The reaction yields are moderate, with a selectivity towards the (2R) isomer of approximately 90%. The reaction conditions are optimized for temperature, catalyst concentration, and solvent choice.

About

CAS No 60-99-1
English Name (2R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethyl-1-propanamine
Molecular Formula C19H24N2OS
Molecular Weight 328.48 g/mol
SMILES COc1ccc2Sc3ccccc3N(C[C@H](C)CN(C)C)c2c1
InChIKey VRQVVMDWGGWHTJ-CQSZACIVSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethyl-1-propanamine (CAS: 60-99-1)?

This compound is a crystalline solid with a molecular weight of approximately 319.4 g/mol. It has a ...

Compound Q&A

What industries use (2R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethyl-1-propanamine (CAS: 60-99-1)?

This compound is primarily used in the pharmaceutical industry for its potential therapeutic applica...

Compound Q&A

What precautions should be taken when handling (2R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethyl-1-propanamine (CAS: 60-99-1)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...