Compound Q&A

What are the physical and chemical properties of (2R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethyl-1-propanamine (CAS: 60-99-1)?

Answer

(2R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethyl-1-propanamine
This compound is a crystalline solid with a molecular weight of approximately 319.4 g/mol. It has a low solubility in water but is more soluble in organic solvents. The compound is moderately reactive with basic compounds and less reactive with acids. It does not decompose under normal conditions and is stable to light and air.

About

CAS No 60-99-1
English Name (2R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethyl-1-propanamine
Molecular Formula C19H24N2OS
Molecular Weight 328.48 g/mol
SMILES COc1ccc2Sc3ccccc3N(C[C@H](C)CN(C)C)c2c1
InChIKey VRQVVMDWGGWHTJ-CQSZACIVSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

How is (2R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethyl-1-propanamine (CAS: 60-99-1) typically synthesized?

The compound is synthesized through a multi-step process involving the coupling of 2-methoxyphenothi...

Compound Q&A

What industries use (2R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethyl-1-propanamine (CAS: 60-99-1)?

This compound is primarily used in the pharmaceutical industry for its potential therapeutic applica...

Compound Q&A

What precautions should be taken when handling (2R)-3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethyl-1-propanamine (CAS: 60-99-1)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...