Compound Q&A

What industries use Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9)?

Answer

Dimethyl 2,3,5,6-tetrafluoroterephthalate
Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9) is primarily used in the pharmaceutical and polymer industries. It serves as a monomer for the synthesis of fluorinated polymers, which are important in electronic and optical applications. Additionally, it is utilized in the production of fluorinated resins and films, enhancing their chemical and thermal stability. Its unique properties also make it suitable for applications in sensors and semiconductors.

About

CAS No 727-55-9
English Name Dimethyl 2,3,5,6-tetrafluoroterephthalate
Molecular Formula C10H6F4O4
Molecular Weight 266.15 g/mol
SMILES Fc1c(C(=O)OC)c(F)c(F)c(C(=O)OC)c1F
InChIKey JCEMPCVTIITKAC-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9)?

Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9) is a crystalline compound with a molecular...

Compound Q&A

How is Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9) typically synthesized?

Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9) is usually synthesized via the esterificat...

Compound Q&A

What precautions should be taken when handling Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9)?

When handling Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9), it is crucial to use person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...