Compound Q&A

What are the physical and chemical properties of Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9)?

Answer

Dimethyl 2,3,5,6-tetrafluoroterephthalate
Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9) is a crystalline compound with a molecular weight of approximately 297.07 g/mol. It is sparingly soluble in water but highly soluble in organic solvents like benzene and toluene. Chemically, it is less reactive compared to other terephthalates, showing limited reactivity towards nucleophiles and electrophiles. It has a melting point around 125°C and a boiling point of about 300°C. This compound is known for its stability under normal conditions, which makes it suitable for various industrial applications.

About

CAS No 727-55-9
English Name Dimethyl 2,3,5,6-tetrafluoroterephthalate
Molecular Formula C10H6F4O4
Molecular Weight 266.15 g/mol
SMILES Fc1c(C(=O)OC)c(F)c(F)c(C(=O)OC)c1F
InChIKey JCEMPCVTIITKAC-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

How is Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9) typically synthesized?

Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9) is usually synthesized via the esterificat...

Compound Q&A

What industries use Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9)?

Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9) is primarily used in the pharmaceutical an...

Compound Q&A

What precautions should be taken when handling Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9)?

When handling Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9), it is crucial to use person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...