Compound Q&A

How is Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9) typically synthesized?

Answer

Dimethyl 2,3,5,6-tetrafluoroterephthalate
Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9) is usually synthesized via the esterification of 2,3,5,6-tetrafluoroterephthalic acid with dimethyl carbonate in the presence of a strong acid catalyst, such as trifluoroacetic acid. The reaction is conducted under mild conditions, typically at room temperature. The process yields high selectivity and good yield, making it a common method for industrial-scale production.

About

CAS No 727-55-9
English Name Dimethyl 2,3,5,6-tetrafluoroterephthalate
Molecular Formula C10H6F4O4
Molecular Weight 266.15 g/mol
SMILES Fc1c(C(=O)OC)c(F)c(F)c(C(=O)OC)c1F
InChIKey JCEMPCVTIITKAC-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9)?

Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9) is a crystalline compound with a molecular...

Compound Q&A

What industries use Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9)?

Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9) is primarily used in the pharmaceutical an...

Compound Q&A

What precautions should be taken when handling Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9)?

When handling Dimethyl 2,3,5,6-tetrafluoroterephthalate (CAS: 727-55-9), it is crucial to use person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...