Compound Q&A

What precautions should be taken when handling 6-Acetamido-2-pyridinecarboxylic acid (CAS: 26893-72-1)?

Answer

6-Acetamido-2-pyridinecarboxylic acid
When handling 6-Acetamido-2-pyridinecarboxylic acid (CAS: 26893-72-1), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coat to protect against skin and eye contact. The compound should be stored in a dry, cool place away from heat sources and incompatible materials. In case of a spill, the area should be thoroughly cleaned with water and appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

CAS No 26893-72-1
English Name 6-Acetamido-2-pyridinecarboxylic acid
Molecular Formula C8H8N2O3
Molecular Weight 180.16 g/mol
SMILES CC(=O)NC1=CC=CC(=N1)C(=O)O
InChIKey LOMWKYHCHCZVCC-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Acetamido-2-pyridinecarboxylic acid (CAS: 26893-72-1)?

6-Acetamido-2-pyridinecarboxylic acid (CAS: 26893-72-1) is a white crystalline solid with a molecula...

Compound Q&A

How is 6-Acetamido-2-pyridinecarboxylic acid (CAS: 26893-72-1) typically synthesized?

6-Acetamido-2-pyridinecarboxylic acid is typically synthesized through a multi-step process involvin...

Compound Q&A

What industries use 6-Acetamido-2-pyridinecarboxylic acid (CAS: 26893-72-1)?

6-Acetamido-2-pyridinecarboxylic acid (CAS: 26893-72-1) is primarily used in the pharmaceutical indu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...