Compound Q&A

How is 6-Acetamido-2-pyridinecarboxylic acid (CAS: 26893-72-1) typically synthesized?

Answer

6-Acetamido-2-pyridinecarboxylic acid
6-Acetamido-2-pyridinecarboxylic acid is typically synthesized through a multi-step process involving the condensation of 2-pyridinecarboxylic acid with acetic anhydride in the presence of a catalytic amount of an acid or base. The reaction is carried out in a suitable solvent such as ethanol or toluene, yielding a high purity product with good selectivity and a yield of around 80-85%.

About

CAS No 26893-72-1
English Name 6-Acetamido-2-pyridinecarboxylic acid
Molecular Formula C8H8N2O3
Molecular Weight 180.16 g/mol
SMILES CC(=O)NC1=CC=CC(=N1)C(=O)O
InChIKey LOMWKYHCHCZVCC-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Acetamido-2-pyridinecarboxylic acid (CAS: 26893-72-1)?

6-Acetamido-2-pyridinecarboxylic acid (CAS: 26893-72-1) is a white crystalline solid with a molecula...

Compound Q&A

What industries use 6-Acetamido-2-pyridinecarboxylic acid (CAS: 26893-72-1)?

6-Acetamido-2-pyridinecarboxylic acid (CAS: 26893-72-1) is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 6-Acetamido-2-pyridinecarboxylic acid (CAS: 26893-72-1)?

When handling 6-Acetamido-2-pyridinecarboxylic acid (CAS: 26893-72-1), it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...