Compound Q&A

What precautions should be taken when handling 5-Chloro-2-(trifluoromethyl)nicotinic acid (CAS: 823222-02-2)?

Answer

5-Chloro-2-(trifluoromethyl)nicotinic acid
When handling 5-Chloro-2-(trifluoromethyl)nicotinic acid, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be done in a well-ventilated fume hood or a chemical fume exhaust system. Spills should be cleaned up immediately using appropriate materials, and the area should be decontaminated. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name 5-Chloro-2-(trifluoromethyl)nicotinic acid
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES c1c(cnc(c1C(=O)O)C(F)(F)F)Cl
InChIKey SWAUZBSMIIDEMA-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Chloro-2-(trifluoromethyl)nicotinic acid (CAS: 823222-02-2)?

5-Chloro-2-(trifluoromethyl)nicotinic acid is a crystalline solid with a molecular weight of approxi...

Compound Q&A

How is 5-Chloro-2-(trifluoromethyl)nicotinic acid (CAS: 823222-02-2) typically synthesized?

5-Chloro-2-(trifluoromethyl)nicotinic acid is typically synthesized via acylation of 2-chloronicotin...

Compound Q&A

What industries use 5-Chloro-2-(trifluoromethyl)nicotinic acid (CAS: 823222-02-2)?

5-Chloro-2-(trifluoromethyl)nicotinic acid is used in the pharmaceutical industry for the synthesis ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...