Compound Q&A

What are the physical and chemical properties of 5-Chloro-2-(trifluoromethyl)nicotinic acid (CAS: 823222-02-2)?

Answer

5-Chloro-2-(trifluoromethyl)nicotinic acid
5-Chloro-2-(trifluoromethyl)nicotinic acid is a crystalline solid with a molecular weight of approximately 262.02 g/mol. It has a low solubility in water but is soluble in organic solvents like methanol and acetonitrile. Chemically, it is relatively stable but can react with bases to form salts. It is also sensitive to moisture and should be stored in a sealed container.

About

English Name 5-Chloro-2-(trifluoromethyl)nicotinic acid
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES c1c(cnc(c1C(=O)O)C(F)(F)F)Cl
InChIKey SWAUZBSMIIDEMA-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

How is 5-Chloro-2-(trifluoromethyl)nicotinic acid (CAS: 823222-02-2) typically synthesized?

5-Chloro-2-(trifluoromethyl)nicotinic acid is typically synthesized via acylation of 2-chloronicotin...

Compound Q&A

What industries use 5-Chloro-2-(trifluoromethyl)nicotinic acid (CAS: 823222-02-2)?

5-Chloro-2-(trifluoromethyl)nicotinic acid is used in the pharmaceutical industry for the synthesis ...

Compound Q&A

What precautions should be taken when handling 5-Chloro-2-(trifluoromethyl)nicotinic acid (CAS: 823222-02-2)?

When handling 5-Chloro-2-(trifluoromethyl)nicotinic acid, it is crucial to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...