Compound Q&A

How is 5-Chloro-2-(trifluoromethyl)nicotinic acid (CAS: 823222-02-2) typically synthesized?

Answer

5-Chloro-2-(trifluoromethyl)nicotinic acid
5-Chloro-2-(trifluoromethyl)nicotinic acid is typically synthesized via acylation of 2-chloronicotinic acid with trifluoromethyl chloride. This process often involves the use of a Lewis acid catalyst and is carried out under anhydrous conditions to prevent side reactions. The yield is generally good, and the product can be purified by recrystallization.

About

English Name 5-Chloro-2-(trifluoromethyl)nicotinic acid
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES c1c(cnc(c1C(=O)O)C(F)(F)F)Cl
InChIKey SWAUZBSMIIDEMA-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Chloro-2-(trifluoromethyl)nicotinic acid (CAS: 823222-02-2)?

5-Chloro-2-(trifluoromethyl)nicotinic acid is a crystalline solid with a molecular weight of approxi...

Compound Q&A

What industries use 5-Chloro-2-(trifluoromethyl)nicotinic acid (CAS: 823222-02-2)?

5-Chloro-2-(trifluoromethyl)nicotinic acid is used in the pharmaceutical industry for the synthesis ...

Compound Q&A

What precautions should be taken when handling 5-Chloro-2-(trifluoromethyl)nicotinic acid (CAS: 823222-02-2)?

When handling 5-Chloro-2-(trifluoromethyl)nicotinic acid, it is crucial to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...