Compound Q&A

What are the physical and chemical properties of N-(2-Nitrophenyl)methanesulfonamide (CAS: 85150-03-4)?

Answer

N-(2-Nitrophenyl)methanesulfonamide
N-(2-Nitrophenyl)methanesulfonamide (CAS: 85150-03-4) is a white crystalline powder with a molecular weight of approximately 219.13 g/mol. It has a low solubility in water but good solubility in organic solvents like methanol and acetonitrile. This compound is relatively stable under normal conditions but exhibits reactivity towards strong bases and reducing agents.

About

CAS No 85150-03-4
English Name N-(2-Nitrophenyl)methanesulfonamide
Molecular Formula C7H8N2O4S
Molecular Weight 216.22 g/mol
SMILES CS(=O)(=O)NC1=CC=CC=C1[N+](=O)[O-]
InChIKey WFRCGQPFZHHIDL-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

How is N-(2-Nitrophenyl)methanesulfonamide (CAS: 85150-03-4) typically synthesized?

N-(2-Nitrophenyl)methanesulfonamide is typically synthesized by the reaction of 2-nitrophenol with m...

Compound Q&A

What industries use N-(2-Nitrophenyl)methanesulfonamide (CAS: 85150-03-4)?

N-(2-Nitrophenyl)methanesulfonamide (CAS: 85150-03-4) is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling N-(2-Nitrophenyl)methanesulfonamide (CAS: 85150-03-4)?

When handling N-(2-Nitrophenyl)methanesulfonamide (CAS: 85150-03-4), it is important to use appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...