Compound Q&A

What industries use Polyoxyethylene bis(azide) (CAS: 82055-94-5)?

Answer

Polyoxyethylene bis(azide)
Polyoxyethylene bis(azide) is used in various industries, including pharmaceuticals for drug delivery systems, polymers for special applications requiring high reactivity, and sensors for detecting specific analytes. It also finds use in semiconductor manufacturing for photoresists and other applications requiring precise cross-linking.

About

CAS No 82055-94-5
English Name Polyoxyethylene bis(azide)
Molecular Formula C6H12N6O2
Molecular Weight 200.198479652405 g/mol
SMILES O(CCN=[N+]=[N-])CCOCCN=[N+]=[N-]
InChIKey OHZGAFKSAANFAS-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Polyoxyethylene bis(azide) (CAS: 82055-94-5)?

Polyoxyethylene bis(azide) is a white, crystalline solid with a molecular weight of approximately 36...

Compound Q&A

How is Polyoxyethylene bis(azide) (CAS: 82055-94-5) typically synthesized?

Polyoxyethylene bis(azide) is commonly synthesized by the azidation of corresponding polyoxyethylene...

Compound Q&A

What precautions should be taken when handling Polyoxyethylene bis(azide) (CAS: 82055-94-5)?

When handling Polyoxyethylene bis(azide), it is crucial to wear appropriate personal protective equi...

Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) is a crys...

2040295-11-04,4',4'',4'''-(1,1,2...
Compound Q&A

Are there alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol (CAS: 564-73-8) in synthesis?

There are several alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol in syn...

564-73-8(3beta)-Abieta-8,11,...
Compound Q&A

What are the main uses of sec-Butylhydrazine dihydrochloride (CAS: 1177361-36-2)?

Sec-Butylhydrazine dihydrochloride is mainly used as a precursor in the synthesi...

1177361-36-2sec-Butylhydrazine d...
Compound Q&A

How is BIBP3226 TFA (CAS: 1068148-47-9) typically synthesized?

BIBP3226 TFA is synthesized via a multi-step process involving amino acid deriva...

1068148-47-9BIBP3226 TFA