Compound Q&A

What are the physical and chemical properties of Polyoxyethylene bis(azide) (CAS: 82055-94-5)?

Answer

Polyoxyethylene bis(azide)
Polyoxyethylene bis(azide) is a white, crystalline solid with a molecular weight of approximately 360 g/mol. It is slightly soluble in water and organic solvents. Chemically, it is highly reactive due to the presence of azide groups, making it useful in polymerization and cross-linking reactions.

About

CAS No 82055-94-5
English Name Polyoxyethylene bis(azide)
Molecular Formula C6H12N6O2
Molecular Weight 200.198479652405 g/mol
SMILES O(CCN=[N+]=[N-])CCOCCN=[N+]=[N-]
InChIKey OHZGAFKSAANFAS-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

How is Polyoxyethylene bis(azide) (CAS: 82055-94-5) typically synthesized?

Polyoxyethylene bis(azide) is commonly synthesized by the azidation of corresponding polyoxyethylene...

Compound Q&A

What industries use Polyoxyethylene bis(azide) (CAS: 82055-94-5)?

Polyoxyethylene bis(azide) is used in various industries, including pharmaceuticals for drug deliver...

Compound Q&A

What precautions should be taken when handling Polyoxyethylene bis(azide) (CAS: 82055-94-5)?

When handling Polyoxyethylene bis(azide), it is crucial to wear appropriate personal protective equi...

Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) is a crys...

2040295-11-04,4',4'',4'''-(1,1,2...
Compound Q&A

Are there alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol (CAS: 564-73-8) in synthesis?

There are several alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol in syn...

564-73-8(3beta)-Abieta-8,11,...
Compound Q&A

What are the main uses of sec-Butylhydrazine dihydrochloride (CAS: 1177361-36-2)?

Sec-Butylhydrazine dihydrochloride is mainly used as a precursor in the synthesi...

1177361-36-2sec-Butylhydrazine d...
Compound Q&A

How is BIBP3226 TFA (CAS: 1068148-47-9) typically synthesized?

BIBP3226 TFA is synthesized via a multi-step process involving amino acid deriva...

1068148-47-9BIBP3226 TFA