Compound Q&A

How is 2-(Chloromethyl)-4-nitrophenol (CAS: 68783-41-5) typically synthesized?

Answer

2-(Chloromethyl)-4-nitrophenol
2-(Chloromethyl)-4-nitrophenol is typically synthesized through the nitration of 2-(chloromethyl)phenol. The process involves reacting 2-(chloromethyl)phenol with a nitric acid/sulfuric acid mixture under controlled conditions to yield the nitro compound. The reaction can be carried out in a solvent such as acetic acid or another suitable medium.

About

CAS No 68783-41-5
English Name 2-(Chloromethyl)-4-nitrophenol
Molecular Formula C7H6ClNO3
Molecular Weight 372.41 g/mol
SMILES c1cc(c(cc1[N+](=O)[O-])CCl)O
InChIKey PJNPZIYGODMAQE-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(Chloromethyl)-4-nitrophenol (CAS: 68783-41-5)?

2-(Chloromethyl)-4-nitrophenol is a white crystalline solid with a molecular weight of approximately...

Compound Q&A

What industries use 2-(Chloromethyl)-4-nitrophenol (CAS: 68783-41-5)?

2-(Chloromethyl)-4-nitrophenol is primarily used in the pharmaceutical industry for the synthesis of...

Compound Q&A

What precautions should be taken when handling 2-(Chloromethyl)-4-nitrophenol (CAS: 68783-41-5)?

When handling 2-(Chloromethyl)-4-nitrophenol, it is important to use appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...