Compound Q&A

What are the physical and chemical properties of 2-(Chloromethyl)-4-nitrophenol (CAS: 68783-41-5)?

Answer

2-(Chloromethyl)-4-nitrophenol
2-(Chloromethyl)-4-nitrophenol is a white crystalline solid with a molecular weight of approximately 225.03 g/mol. It has a solubility of about 0.025 g/100 mL in water. The compound is reactive, particularly towards nucleophiles, and is often used in synthesis due to its electrophilic aromatic properties. It readily undergoes nitration and substitution reactions.

About

CAS No 68783-41-5
English Name 2-(Chloromethyl)-4-nitrophenol
Molecular Formula C7H6ClNO3
Molecular Weight 372.41 g/mol
SMILES c1cc(c(cc1[N+](=O)[O-])CCl)O
InChIKey PJNPZIYGODMAQE-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

How is 2-(Chloromethyl)-4-nitrophenol (CAS: 68783-41-5) typically synthesized?

2-(Chloromethyl)-4-nitrophenol is typically synthesized through the nitration of 2-(chloromethyl)phe...

Compound Q&A

What industries use 2-(Chloromethyl)-4-nitrophenol (CAS: 68783-41-5)?

2-(Chloromethyl)-4-nitrophenol is primarily used in the pharmaceutical industry for the synthesis of...

Compound Q&A

What precautions should be taken when handling 2-(Chloromethyl)-4-nitrophenol (CAS: 68783-41-5)?

When handling 2-(Chloromethyl)-4-nitrophenol, it is important to use appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...