Compound Q&A

How is 2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid (CAS: 1152782-19-8) typically synthesized?

Answer

2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid
2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid is typically synthesized via the condensation of 2-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxylic acid and benzoyl chloride in the presence of a catalytic amount of a tertiary amine such as N,N'-dimethylaminopyridine. The reaction is carried out in a suitable organic solvent like dichloromethane or toluene, and the product is isolated via recrystallization from a suitable solvent. The yield is generally around 70-80%, and the method is selective and practical for preparative purposes.

About

English Name 2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid
Molecular Formula C20H19F3N2O3
Molecular Weight 392.38 g/mol
SMILES C1CN(CCC1C2=CC=CC=C2C(F)(F)F)C(=O)NC3=CC=CC=C3C(=O)O
InChIKey MEAQCLPMSVEOQF-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid (CAS: 1152782-19-8)?

2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid is a crystalline solid with a ...

Compound Q&A

What industries use 2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid (CAS: 1152782-19-8)?

2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid is primarily used in the pharm...

Compound Q&A

What precautions should be taken when handling 2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid (CAS: 1152782-19-8)?

When handling 2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid, appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...