Compound Q&A

What are the physical and chemical properties of 2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid (CAS: 1152782-19-8)?

Answer

2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid
2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid is a crystalline solid with a molecular weight of approximately 497.35 g/mol. It has a low solubility in water (0.01 g/100 mL at 25°C) and moderate solubility in organic solvents such as methanol and dimethylformamide. This compound is reactive towards hydrolysis and can undergo esterification and amide formation under appropriate conditions. It is stable under normal storage conditions but should be protected from moisture and light.

About

English Name 2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid
Molecular Formula C20H19F3N2O3
Molecular Weight 392.38 g/mol
SMILES C1CN(CCC1C2=CC=CC=C2C(F)(F)F)C(=O)NC3=CC=CC=C3C(=O)O
InChIKey MEAQCLPMSVEOQF-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

How is 2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid (CAS: 1152782-19-8) typically synthesized?

2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid is typically synthesized via t...

Compound Q&A

What industries use 2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid (CAS: 1152782-19-8)?

2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid is primarily used in the pharm...

Compound Q&A

What precautions should be taken when handling 2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid (CAS: 1152782-19-8)?

When handling 2-(4-(2-(Trifluoromethyl)phenyl)piperidine-1-carboxamido)benzoic acid, appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...