Compound Q&A

What industries use 4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3)?

Answer

4-methyl-2-(2-nitrophenyl)oxazole
4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3) is used in a variety of industries. It is often employed in pharmaceuticals as a precursor for drug synthesis, in polymers for its unique chemical properties, and in sensors for its ability to detect specific analytes. Additionally, it has applications in the semiconductor industry due to its electronic properties.

About

English Name 4-methyl-2-(2-nitrophenyl)oxazole
Molecular Formula C10H8N2O3
Molecular Weight 204.18 g/mol
SMILES CC1=COC(=N1)C2=CC=CC=C2[N+](=O)[O-]
InChIKey XKVKKDJHKSYZSZ-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3)?

4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3) is a crystalline compound with a molecular weig...

Compound Q&A

How is 4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3) typically synthesized?

4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3) can be synthesized through a condensation react...

Compound Q&A

What precautions should be taken when handling 4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3)?

When handling 4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3), it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...