Compound Q&A

How is 4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3) typically synthesized?

Answer

4-methyl-2-(2-nitrophenyl)oxazole
4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3) can be synthesized through a condensation reaction between 2-nitrobenzaldehyde and methyl isothiocyanate in the presence of a base such as potassium carbonate. The reaction is performed under mild conditions, and the product is typically isolated by recrystallization. This method ensures high yield and selectivity.

About

English Name 4-methyl-2-(2-nitrophenyl)oxazole
Molecular Formula C10H8N2O3
Molecular Weight 204.18 g/mol
SMILES CC1=COC(=N1)C2=CC=CC=C2[N+](=O)[O-]
InChIKey XKVKKDJHKSYZSZ-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3)?

4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3) is a crystalline compound with a molecular weig...

Compound Q&A

What industries use 4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3)?

4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3) is used in a variety of industries. It is often...

Compound Q&A

What precautions should be taken when handling 4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3)?

When handling 4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3), it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...