Compound Q&A

What are the physical and chemical properties of 4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3)?

Answer

4-methyl-2-(2-nitrophenyl)oxazole
4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3) is a crystalline compound with a molecular weight of approximately 212.08 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. This compound is known for its moderate reactivity, particularly in electrophilic substitution reactions. It is stable under normal laboratory conditions but requires proper handling to avoid decomposition.

About

English Name 4-methyl-2-(2-nitrophenyl)oxazole
Molecular Formula C10H8N2O3
Molecular Weight 204.18 g/mol
SMILES CC1=COC(=N1)C2=CC=CC=C2[N+](=O)[O-]
InChIKey XKVKKDJHKSYZSZ-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

How is 4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3) typically synthesized?

4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3) can be synthesized through a condensation react...

Compound Q&A

What industries use 4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3)?

4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3) is used in a variety of industries. It is often...

Compound Q&A

What precautions should be taken when handling 4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3)?

When handling 4-methyl-2-(2-nitrophenyl)oxazole (CAS: 951884-48-3), it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...