Compound Q&A

What industries use Ethyl 3-(1-benzofuran-2-yl)-3-oxopropanoate (CAS: 78917-44-9)?

Answer

Ethyl 3-(1-benzofuran-2-yl)-3-oxopropanoate
Ethyl 3-(1-benzofuran-2-yl)-3-oxopropanoate (CAS: 78917-44-9) is primarily used in the pharmaceutical and chemical industries. It serves as a key intermediate in the synthesis of various drugs and functionalized compounds. Additionally, it has potential applications in the field of sensors and semiconductors due to its unique chemical properties.

About

CAS No 78917-44-9
English Name Ethyl 3-(1-benzofuran-2-yl)-3-oxopropanoate
Molecular Formula C13H12O4
Molecular Weight 232.24 g/mol
SMILES CCOC(=O)CC(=O)C1=CC2=CC=CC=C2O1
InChIKey DBSJYHCDGBZOEP-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 3-(1-benzofuran-2-yl)-3-oxopropanoate (CAS: 78917-44-9)?

Ethyl 3-(1-benzofuran-2-yl)-3-oxopropanoate (CAS: 78917-44-9) is a crystalline compound with a molec...

Compound Q&A

How is Ethyl 3-(1-benzofuran-2-yl)-3-oxopropanoate (CAS: 78917-44-9) typically synthesized?

Ethyl 3-(1-benzofuran-2-yl)-3-oxopropanoate (CAS: 78917-44-9) is typically synthesized via a multi-s...

Compound Q&A

What precautions should be taken when handling Ethyl 3-(1-benzofuran-2-yl)-3-oxopropanoate (CAS: 78917-44-9)?

When handling Ethyl 3-(1-benzofuran-2-yl)-3-oxopropanoate (CAS: 78917-44-9), it is important to use ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...