Compound Q&A

What are the physical and chemical properties of Ethyl (1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)acetate (CAS: 6974-10-3)?

Answer

Ethyl (1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)acetate
Ethyl (1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)acetate (CAS: 6974-10-3) is a crystalline solid with a molecular weight of approximately 242.27 g/mol. It has a high solubility in organic solvents like ethanol and acetone but is practically insoluble in water. Chemically, it is moderately reactive, showing good stability under neutral and slightly acidic conditions. It is used in organic synthesis and pharmaceutical processes due to its reactivity and specific functional groups.

About

CAS No 6974-10-3
English Name Ethyl (1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)acetate
Molecular Formula C12H11NO4
Molecular Weight 233.22 g/mol
SMILES CCOC(=O)CN1C(=O)C2=CC=CC=C2C1=O
InChIKey NYNCZOLNVTXTTP-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:05

Related Q&A

Compound Q&A

How is Ethyl (1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)acetate (CAS: 6974-10-3) typically synthesized?

Ethyl (1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)acetate (CAS: 6974-10-3) is typically synthesized via ...

Compound Q&A

What industries use Ethyl (1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)acetate (CAS: 6974-10-3)?

Ethyl (1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)acetate (CAS: 6974-10-3) is used in various industries...

Compound Q&A

What precautions should be taken when handling Ethyl (1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)acetate (CAS: 6974-10-3)?

When handling Ethyl (1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)acetate (CAS: 6974-10-3), it is essentia...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...