Compound Q&A

What precautions should be taken when handling 2-Deoxyribose 5-phosphate disodium (CAS: 102916-66-5)?

Answer

2-Deoxyribose 5-phosphate disodium
When handling 2-Deoxyribose 5-phosphate disodium, it is essential to use appropriate personal protective equipment (PPE) such as gloves, lab coat, and safety goggles. Handle in a well-ventilated area or under a fume hood due to its sensitivity to moisture. Spills should be cleaned up immediately using appropriate absorbent material. Always consult the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

About

English Name 2-Deoxyribose 5-phosphate disodium
Molecular Formula C5H10NaO7P
Molecular Weight 237.1 g/mol
SMILES C(C=O)C(C(COP(=O)(O)[O-])O)O.[Na+]
InChIKey ZRNGXBHWCWMPOF-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Deoxyribose 5-phosphate disodium (CAS: 102916-66-5)?

2-Deoxyribose 5-phosphate disodium is a white crystalline powder with a molecular weight of approxim...

Compound Q&A

How is 2-Deoxyribose 5-phosphate disodium (CAS: 102916-66-5) typically synthesized?

2-Deoxyribose 5-phosphate disodium is typically synthesized through the phosphorylation of 2-deoxyri...

Compound Q&A

What industries use 2-Deoxyribose 5-phosphate disodium (CAS: 102916-66-5)?

2-Deoxyribose 5-phosphate disodium is primarily used in the pharmaceutical industry for the synthesi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...