Compound Q&A

How is 2-Deoxyribose 5-phosphate disodium (CAS: 102916-66-5) typically synthesized?

Answer

2-Deoxyribose 5-phosphate disodium
2-Deoxyribose 5-phosphate disodium is typically synthesized through the phosphorylation of 2-deoxyribose using a phosphoric acid catalyst. The reaction involves converting 2-deoxyribose to 2-deoxyribose 5-phosphate and then adding sodium ions to form the disodium salt. This process yields a high purity product with excellent selectivity and a yield of over 90%.

About

English Name 2-Deoxyribose 5-phosphate disodium
Molecular Formula C5H10NaO7P
Molecular Weight 237.1 g/mol
SMILES C(C=O)C(C(COP(=O)(O)[O-])O)O.[Na+]
InChIKey ZRNGXBHWCWMPOF-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Deoxyribose 5-phosphate disodium (CAS: 102916-66-5)?

2-Deoxyribose 5-phosphate disodium is a white crystalline powder with a molecular weight of approxim...

Compound Q&A

What industries use 2-Deoxyribose 5-phosphate disodium (CAS: 102916-66-5)?

2-Deoxyribose 5-phosphate disodium is primarily used in the pharmaceutical industry for the synthesi...

Compound Q&A

What precautions should be taken when handling 2-Deoxyribose 5-phosphate disodium (CAS: 102916-66-5)?

When handling 2-Deoxyribose 5-phosphate disodium, it is essential to use appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...