Compound Q&A

What are the physical and chemical properties of 2-Deoxyribose 5-phosphate disodium (CAS: 102916-66-5)?

Answer

2-Deoxyribose 5-phosphate disodium
2-Deoxyribose 5-phosphate disodium is a white crystalline powder with a molecular weight of approximately 295.13 g/mol. It is highly soluble in water and has limited solubility in organic solvents. Its reactivity is moderate, making it suitable for use in biological and chemical synthesis. It is stable under normal storage conditions but can be sensitive to strong acids and bases.

About

English Name 2-Deoxyribose 5-phosphate disodium
Molecular Formula C5H10NaO7P
Molecular Weight 237.1 g/mol
SMILES C(C=O)C(C(COP(=O)(O)[O-])O)O.[Na+]
InChIKey ZRNGXBHWCWMPOF-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:05

Related Q&A

Compound Q&A

How is 2-Deoxyribose 5-phosphate disodium (CAS: 102916-66-5) typically synthesized?

2-Deoxyribose 5-phosphate disodium is typically synthesized through the phosphorylation of 2-deoxyri...

Compound Q&A

What industries use 2-Deoxyribose 5-phosphate disodium (CAS: 102916-66-5)?

2-Deoxyribose 5-phosphate disodium is primarily used in the pharmaceutical industry for the synthesi...

Compound Q&A

What precautions should be taken when handling 2-Deoxyribose 5-phosphate disodium (CAS: 102916-66-5)?

When handling 2-Deoxyribose 5-phosphate disodium, it is essential to use appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...