Compound Q&A

What precautions should be taken when handling 1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0)?

Answer

1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene
When handling 1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0), appropriate personal protective equipment (PPE) should be used, including gloves, goggles, and a lab coat. The compound should be handled in a fume hood to minimize exposure. Spills should be cleaned up using appropriate absorbents, and contact with skin or eyes should be avoided. Always refer to a safety data sheet (SDS) for detailed handling instructions.

About

English Name 1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene
Molecular Formula C12H5Br5O
Molecular Weight 564.69 g/mol
SMILES C1=CC(=C(C=C1Br)Br)OC2=C(C(=C(C=C2)Br)Br)Br
InChIKey DMLQSUZPTTUUDP-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0)?

1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0) is a crystalline solid with a high m...

Compound Q&A

How is 1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0) typically synthesized?

1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0) is typically synthesized through a m...

Compound Q&A

What industries use 1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0)?

1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0) is used in the pharmaceutical and po...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...