Compound Q&A

What industries use 1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0)?

Answer

1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene
1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0) is used in the pharmaceutical and polymer industries for the synthesis of advanced materials and drug intermediates. It also has potential applications in sensors and semiconductors due to its unique electronic properties.

About

English Name 1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene
Molecular Formula C12H5Br5O
Molecular Weight 564.69 g/mol
SMILES C1=CC(=C(C=C1Br)Br)OC2=C(C(=C(C=C2)Br)Br)Br
InChIKey DMLQSUZPTTUUDP-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0)?

1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0) is a crystalline solid with a high m...

Compound Q&A

How is 1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0) typically synthesized?

1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0) is typically synthesized through a m...

Compound Q&A

What precautions should be taken when handling 1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0)?

When handling 1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0), appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...