Compound Q&A

What are the physical and chemical properties of 1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0)?

Answer

1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene
1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0) is a crystalline solid with a high molecular weight. It has poor water solubility and low solubility in common organic solvents. The compound is highly reactive due to the presence of multiple bromine substituents. It does not react readily with many common reagents but can participate in substitution reactions under certain conditions.

About

English Name 1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene
Molecular Formula C12H5Br5O
Molecular Weight 564.69 g/mol
SMILES C1=CC(=C(C=C1Br)Br)OC2=C(C(=C(C=C2)Br)Br)Br
InChIKey DMLQSUZPTTUUDP-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:05

Related Q&A

Compound Q&A

How is 1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0) typically synthesized?

1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0) is typically synthesized through a m...

Compound Q&A

What industries use 1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0)?

1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0) is used in the pharmaceutical and po...

Compound Q&A

What precautions should be taken when handling 1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0)?

When handling 1,2,3-Tribromo-4-(2,4-dibromophenoxy)benzene (CAS: 182346-21-0), appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...