Compound Q&A

How is 4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine (CAS: 1266181-51-4) typically synthesized?

Answer

4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine
4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine can be synthesized via a multistep process involving the condensation of 2-pyridine carboxaldehyde with 3,5-di(2-pyridinyl)phenylisocyanate followed by the reaction with 2-methylpyrimidine. This process involves the use of catalysts such as 4-dimethylaminopyridine (DMAP) and typically yields the compound with high selectivity and good purity.

About

English Name 4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine
Molecular Formula C37H26N6
Molecular Weight 554.64 g/mol
SMILES Cc1nc(cc(n1)c1cc(cc(c1)c1ccccn1)c1ccccn1)c1cc(cc(c1)c1ccccn1)c1ccccn1
InChIKey JBSGZQMUNSLKLU-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine (CAS: 1266181-51-4)?

4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine is a crystalline solid with a molecular weight...

Compound Q&A

What industries use 4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine (CAS: 1266181-51-4)?

4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling 4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine (CAS: 1266181-51-4)?

When handling 4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine, it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...