Compound Q&A

What are the physical and chemical properties of 4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine (CAS: 1266181-51-4)?

Answer

4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine
4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine is a crystalline solid with a molecular weight of approximately 636.4 g/mol. It is poorly soluble in water but soluble in organic solvents like DMF, DMSO, and acetonitrile. Chemically, it exhibits moderate reactivity, particularly towards nucleophilic substitution reactions. It does not react readily with electrophiles, making it suitable for various synthetic applications.

About

English Name 4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine
Molecular Formula C37H26N6
Molecular Weight 554.64 g/mol
SMILES Cc1nc(cc(n1)c1cc(cc(c1)c1ccccn1)c1ccccn1)c1cc(cc(c1)c1ccccn1)c1ccccn1
InChIKey JBSGZQMUNSLKLU-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:35

Related Q&A

Compound Q&A

How is 4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine (CAS: 1266181-51-4) typically synthesized?

4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine can be synthesized via a multistep process inv...

Compound Q&A

What industries use 4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine (CAS: 1266181-51-4)?

4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling 4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine (CAS: 1266181-51-4)?

When handling 4,6-Bis[3,5-di(2-pyridinyl)phenyl]-2-methylpyrimidine, it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...