Compound Q&A

What precautions should be taken when handling [3-(1-Piperidinylsulfonyl)phenyl]boronic acid (CAS: 690662-96-5)?

Answer

[3-(1-Piperidinylsulfonyl)phenyl]boronic acid
When handling [3-(1-Piperidinylsulfonyl)phenyl]boronic acid, it is important to wear protective equipment such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure to the compound. Spills should be cleaned up immediately with appropriate absorbents, and the area should be ventilated. Always consult the Material Safety Data Sheet (MSDS/SDS) for detailed safety information and emergency procedures.

About

English Name [3-(1-Piperidinylsulfonyl)phenyl]boronic acid
Molecular Formula C11H16BNO4S
Molecular Weight 269.13 g/mol
SMILES B(C1=CC(=CC=C1)S(=O)(=O)N2CCCCC2)(O)O
InChIKey HQOWPGGTRBFYFE-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-(1-Piperidinylsulfonyl)phenyl]boronic acid (CAS: 690662-96-5)?

[3-(1-Piperidinylsulfonyl)phenyl]boronic acid is a crystalline compound with a molecular weight of a...

Compound Q&A

How is [3-(1-Piperidinylsulfonyl)phenyl]boronic acid (CAS: 690662-96-5) typically synthesized?

[3-(1-Piperidinylsulfonyl)phenyl]boronic acid is typically synthesized by the reaction of 3-halophen...

Compound Q&A

What industries use [3-(1-Piperidinylsulfonyl)phenyl]boronic acid (CAS: 690662-96-5)?

[3-(1-Piperidinylsulfonyl)phenyl]boronic acid is used in the pharmaceutical industry for designing a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...