Compound Q&A

What industries use [3-(1-Piperidinylsulfonyl)phenyl]boronic acid (CAS: 690662-96-5)?

Answer

[3-(1-Piperidinylsulfonyl)phenyl]boronic acid
[3-(1-Piperidinylsulfonyl)phenyl]boronic acid is used in the pharmaceutical industry for designing and synthesizing complex molecules. It is also used in the polymer industry for the modification of polymers, and in the sensor industry for developing chemical sensors. Additionally, it has potential applications in the semiconductor industry for the production of electronic materials.

About

English Name [3-(1-Piperidinylsulfonyl)phenyl]boronic acid
Molecular Formula C11H16BNO4S
Molecular Weight 269.13 g/mol
SMILES B(C1=CC(=CC=C1)S(=O)(=O)N2CCCCC2)(O)O
InChIKey HQOWPGGTRBFYFE-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-(1-Piperidinylsulfonyl)phenyl]boronic acid (CAS: 690662-96-5)?

[3-(1-Piperidinylsulfonyl)phenyl]boronic acid is a crystalline compound with a molecular weight of a...

Compound Q&A

How is [3-(1-Piperidinylsulfonyl)phenyl]boronic acid (CAS: 690662-96-5) typically synthesized?

[3-(1-Piperidinylsulfonyl)phenyl]boronic acid is typically synthesized by the reaction of 3-halophen...

Compound Q&A

What precautions should be taken when handling [3-(1-Piperidinylsulfonyl)phenyl]boronic acid (CAS: 690662-96-5)?

When handling [3-(1-Piperidinylsulfonyl)phenyl]boronic acid, it is important to wear protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...