Compound Q&A

What are the physical and chemical properties of [3-(1-Piperidinylsulfonyl)phenyl]boronic acid (CAS: 690662-96-5)?

Answer

[3-(1-Piperidinylsulfonyl)phenyl]boronic acid
[3-(1-Piperidinylsulfonyl)phenyl]boronic acid is a crystalline compound with a molecular weight of approximately 328.34 g/mol. It has a relatively low solubility in water but is soluble in organic solvents like DMSO and DMF. It is moderately reactive and can participate in various organometallic reactions. This compound is stable under normal conditions but may degrade at high temperatures or in the presence of strong acids or bases.

About

English Name [3-(1-Piperidinylsulfonyl)phenyl]boronic acid
Molecular Formula C11H16BNO4S
Molecular Weight 269.13 g/mol
SMILES B(C1=CC(=CC=C1)S(=O)(=O)N2CCCCC2)(O)O
InChIKey HQOWPGGTRBFYFE-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:35

Related Q&A

Compound Q&A

How is [3-(1-Piperidinylsulfonyl)phenyl]boronic acid (CAS: 690662-96-5) typically synthesized?

[3-(1-Piperidinylsulfonyl)phenyl]boronic acid is typically synthesized by the reaction of 3-halophen...

Compound Q&A

What industries use [3-(1-Piperidinylsulfonyl)phenyl]boronic acid (CAS: 690662-96-5)?

[3-(1-Piperidinylsulfonyl)phenyl]boronic acid is used in the pharmaceutical industry for designing a...

Compound Q&A

What precautions should be taken when handling [3-(1-Piperidinylsulfonyl)phenyl]boronic acid (CAS: 690662-96-5)?

When handling [3-(1-Piperidinylsulfonyl)phenyl]boronic acid, it is important to wear protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...