Compound Q&A

What industries use Methyl 8-methylquinoline-7-carboxylate (CAS: 1030846-94-6)?

Answer

Methyl 8-methylquinoline-7-carboxylate
Methyl 8-methylquinoline-7-carboxylate (CAS: 1030846-94-6) is primarily used in the pharmaceutical and material science industries. It serves as a precursor in the synthesis of various organic compounds and is also utilized in the development of advanced materials. Its unique chemical structure makes it suitable for applications in the preparation of sensors and semiconductors.

About

English Name Methyl 8-methylquinoline-7-carboxylate
Molecular Formula C12H11NO2
Molecular Weight 201.23 g/mol
SMILES CC1=C(C=CC2=C1N=CC=C2)C(=O)OC
InChIKey HYUFGCAJWJEANP-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 8-methylquinoline-7-carboxylate (CAS: 1030846-94-6)?

Methyl 8-methylquinoline-7-carboxylate (CAS: 1030846-94-6) is a crystalline solid with a molecular w...

Compound Q&A

How is Methyl 8-methylquinoline-7-carboxylate (CAS: 1030846-94-6) typically synthesized?

Methyl 8-methylquinoline-7-carboxylate (CAS: 1030846-94-6) is typically synthesized through the cond...

Compound Q&A

What precautions should be taken when handling Methyl 8-methylquinoline-7-carboxylate (CAS: 1030846-94-6)?

When handling Methyl 8-methylquinoline-7-carboxylate (CAS: 1030846-94-6), it is important to follow ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...