Compound Q&A

What industries use 5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid (CAS: 82-50-8)?

Answer

5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid
5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid is used in the pharmaceutical industry for the synthesis of certain organic compounds. It is also employed in the production of sensors and semiconductors due to its acid properties and stability under specific conditions. Additionally, it finds applications in analytical chemistry for its reactivity with various compounds.

About

CAS No 82-50-8
English Name 5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid
Molecular Formula C14H7NO7S
Molecular Weight 333.27 g/mol
SMILES C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)C3=C(C2=O)C(=CC=C3)S(=O)(=O)O
InChIKey JFORTLRWSWJGGI-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid (CAS: 82-50-8)?

5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid is a crystalline compound with a molecular...

Compound Q&A

How is 5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid (CAS: 82-50-8) typically synthesized?

5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid is typically synthesized by nitration of a...

Compound Q&A

What precautions should be taken when handling 5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid (CAS: 82-50-8)?

When handling 5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid, it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...