Compound Q&A

How is 5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid (CAS: 82-50-8) typically synthesized?

Answer

5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid
5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid is typically synthesized by nitration of anthracene-9,10-dione followed by sulfonation. The process involves the treatment of anthracene-9,10-dione with nitric acid to form the nitro derivative, which is then sulfonated using sulfur trioxide (SO3) or sulfuryl chloride (SO2Cl2). The reaction proceeds under controlled conditions to achieve high yield and selectivity.

About

CAS No 82-50-8
English Name 5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid
Molecular Formula C14H7NO7S
Molecular Weight 333.27 g/mol
SMILES C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)C3=C(C2=O)C(=CC=C3)S(=O)(=O)O
InChIKey JFORTLRWSWJGGI-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid (CAS: 82-50-8)?

5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid is a crystalline compound with a molecular...

Compound Q&A

What industries use 5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid (CAS: 82-50-8)?

5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid is used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling 5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid (CAS: 82-50-8)?

When handling 5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid, it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...