Compound Q&A

What are the physical and chemical properties of 5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid (CAS: 82-50-8)?

Answer

5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid
5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid is a crystalline compound with a molecular weight of approximately 318.11 g/mol. It has a highly acidic nature with a pKa of about 2.5. The compound is slightly soluble in water, with a solubility of 0.05 g/100 mL. It is not reactive under normal conditions but can decompose at high temperatures. This compound exhibits strong acidity and is often used in analytical chemistry for its acid-base properties.

About

CAS No 82-50-8
English Name 5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid
Molecular Formula C14H7NO7S
Molecular Weight 333.27 g/mol
SMILES C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)C3=C(C2=O)C(=CC=C3)S(=O)(=O)O
InChIKey JFORTLRWSWJGGI-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

How is 5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid (CAS: 82-50-8) typically synthesized?

5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid is typically synthesized by nitration of a...

Compound Q&A

What industries use 5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid (CAS: 82-50-8)?

5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid is used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling 5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid (CAS: 82-50-8)?

When handling 5-Nitro-9,10-dioxo-9,10-dihydro-1-anthracenesulfonic acid, it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...