Compound Q&A

What precautions should be taken when handling Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4)?

Answer

Bis(pentamethylcyclopentadienyl)nickel
When handling Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure. Spills should be cleaned up using appropriate absorbent materials, and the area should be thoroughly ventilated. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

CAS No 74507-63-4
English Name Bis(pentamethylcyclopentadienyl)nickel
Molecular Formula C20H30Ni
Molecular Weight 329.15 g/mol
SMILES C[C-]1C(=C(C(=C1C)C)C)C.C[C-]1C(=C(C(=C1C)C)C)C.[Ni+2]
InChIKey UYYQGUNMWLFPIW-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4)?

Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4) is a solid compound with a crystalline form...

Compound Q&A

How is Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4) typically synthesized?

Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4) is typically synthesized via the reaction o...

Compound Q&A

What industries use Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4)?

Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4) is primarily used in the catalytic industry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...