Compound Q&A

How is Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4) typically synthesized?

Answer

Bis(pentamethylcyclopentadienyl)nickel
Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4) is typically synthesized via the reaction of nickel(II) chloride with pentamethylcyclopentadiene in an inert atmosphere. Commonly, this involves a careful reduction of nickel(II) species to nickel(0) in the presence of the ligand, followed by amination to form the bis(pentamethylcyclopentadienyl) complex.

About

CAS No 74507-63-4
English Name Bis(pentamethylcyclopentadienyl)nickel
Molecular Formula C20H30Ni
Molecular Weight 329.15 g/mol
SMILES C[C-]1C(=C(C(=C1C)C)C)C.C[C-]1C(=C(C(=C1C)C)C)C.[Ni+2]
InChIKey UYYQGUNMWLFPIW-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4)?

Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4) is a solid compound with a crystalline form...

Compound Q&A

What industries use Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4)?

Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4) is primarily used in the catalytic industry...

Compound Q&A

What precautions should be taken when handling Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4)?

When handling Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4), it is essential to use perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...