Compound Q&A

What industries use Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4)?

Answer

Bis(pentamethylcyclopentadienyl)nickel
Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4) is primarily used in the catalytic industry, particularly in the production of olefins and alkynes. It is also used in the synthesis of various organic compounds, and may have applications in the pharmaceutical and polymer industries due to its unique reactivity and stability.

About

CAS No 74507-63-4
English Name Bis(pentamethylcyclopentadienyl)nickel
Molecular Formula C20H30Ni
Molecular Weight 329.15 g/mol
SMILES C[C-]1C(=C(C(=C1C)C)C)C.C[C-]1C(=C(C(=C1C)C)C)C.[Ni+2]
InChIKey UYYQGUNMWLFPIW-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4)?

Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4) is a solid compound with a crystalline form...

Compound Q&A

How is Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4) typically synthesized?

Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4) is typically synthesized via the reaction o...

Compound Q&A

What precautions should be taken when handling Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4)?

When handling Bis(pentamethylcyclopentadienyl)nickel (CAS: 74507-63-4), it is essential to use perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...