Compound Q&A

How is 4-(3-Fluorophenyl)-4-oxobutanoic acid (CAS: 69797-46-2) typically synthesized?

Answer

4-(3-Fluorophenyl)-4-oxobutanoic acid
4-(3-Fluorophenyl)-4-oxobutanoic acid is typically synthesized via a multistep process involving the coupling of 3-fluorophenylacetyl chloride with phenylboronic acid followed by a hydrogenation step to introduce the oxo group. Common catalysts used include palladium on carbon, and the overall yield can be up to 70% with good selectivity. The reaction conditions should be carefully controlled to avoid side reactions and ensure high purity.

About

CAS No 69797-46-2
English Name 4-(3-Fluorophenyl)-4-oxobutanoic acid
Molecular Formula C10H9FO3
Molecular Weight 196.18 g/mol
SMILES C1=CC(=CC(=C1)F)C(=O)CCC(=O)O
InChIKey HHVYNFFVNGZSNG-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(3-Fluorophenyl)-4-oxobutanoic acid (CAS: 69797-46-2)?

4-(3-Fluorophenyl)-4-oxobutanoic acid (CAS: 69797-46-2) is a white crystalline solid with a molecula...

Compound Q&A

What industries use 4-(3-Fluorophenyl)-4-oxobutanoic acid (CAS: 69797-46-2)?

4-(3-Fluorophenyl)-4-oxobutanoic acid (CAS: 69797-46-2) is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 4-(3-Fluorophenyl)-4-oxobutanoic acid (CAS: 69797-46-2)?

When handling 4-(3-Fluorophenyl)-4-oxobutanoic acid (CAS: 69797-46-2), it is essential to use person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...