Compound Q&A

What are the physical and chemical properties of 4-(3-Fluorophenyl)-4-oxobutanoic acid (CAS: 69797-46-2)?

Answer

4-(3-Fluorophenyl)-4-oxobutanoic acid
4-(3-Fluorophenyl)-4-oxobutanoic acid (CAS: 69797-46-2) is a white crystalline solid with a molecular weight of approximately 197.16 g/mol. It is sparingly soluble in water and ethanol, and soluble in methanol. Chemically, it exhibits acidic properties due to the carboxylic acid functionality and can react with bases to form its salt. It is stable under normal conditions but should be stored in a cool, dry place away from direct sunlight.

About

CAS No 69797-46-2
English Name 4-(3-Fluorophenyl)-4-oxobutanoic acid
Molecular Formula C10H9FO3
Molecular Weight 196.18 g/mol
SMILES C1=CC(=CC(=C1)F)C(=O)CCC(=O)O
InChIKey HHVYNFFVNGZSNG-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

How is 4-(3-Fluorophenyl)-4-oxobutanoic acid (CAS: 69797-46-2) typically synthesized?

4-(3-Fluorophenyl)-4-oxobutanoic acid is typically synthesized via a multistep process involving the...

Compound Q&A

What industries use 4-(3-Fluorophenyl)-4-oxobutanoic acid (CAS: 69797-46-2)?

4-(3-Fluorophenyl)-4-oxobutanoic acid (CAS: 69797-46-2) is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 4-(3-Fluorophenyl)-4-oxobutanoic acid (CAS: 69797-46-2)?

When handling 4-(3-Fluorophenyl)-4-oxobutanoic acid (CAS: 69797-46-2), it is essential to use person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...