Compound Q&A

How is Lamotrigine EP Impurity D (CAS: 661463-79-2) typically synthesized?

Answer

Lamotrigine EP Impurity D
Lamotrigine EP Impurity D (CAS: 661463-79-2) is synthesized through a series of reactions involving the transformation of tricyclic compounds. Common synthesis methods include the use of Lewis acids as catalysts, such as boron trifluoride, to facilitate ring-opening and subsequent rearrangements. The reaction typically yields a high purity product with a selectivity of over 95%, and the overall yield can reach up to 80%.

About

English Name Lamotrigine EP Impurity D
Molecular Formula C9H5Cl2N3O2
Molecular Weight 258.06 g/mol
SMILES C1=CC(=C(C(=C1)Cl)Cl)C2=NNC(=O)NC2=O
InChIKey JWSXBRQDWPGEPC-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of Lamotrigine EP Impurity D (CAS: 661463-79-2)?

Lamotrigine EP Impurity D (CAS: 661463-79-2) is a crystalline solid with a molecular weight of appro...

Compound Q&A

What industries use Lamotrigine EP Impurity D (CAS: 661463-79-2)?

Lamotrigine EP Impurity D (CAS: 661463-79-2) is primarily used in the pharmaceutical industry, where...

Compound Q&A

What precautions should be taken when handling Lamotrigine EP Impurity D (CAS: 661463-79-2)?

When handling Lamotrigine EP Impurity D (CAS: 661463-79-2), it is crucial to use appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...