Compound Q&A

What are the physical and chemical properties of Lamotrigine EP Impurity D (CAS: 661463-79-2)?

Answer

Lamotrigine EP Impurity D
Lamotrigine EP Impurity D (CAS: 661463-79-2) is a crystalline solid with a molecular weight of approximately 276.28 g/mol. It has a melting point of around 165°C and a solubility of about 1.5 mg/mL in water. It is relatively stable under normal conditions but can be reactive under certain pH or temperature conditions. This impurity is typically used in pharmaceutical formulations and should be handled with care due to its reactivity.

About

English Name Lamotrigine EP Impurity D
Molecular Formula C9H5Cl2N3O2
Molecular Weight 258.06 g/mol
SMILES C1=CC(=C(C(=C1)Cl)Cl)C2=NNC(=O)NC2=O
InChIKey JWSXBRQDWPGEPC-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

How is Lamotrigine EP Impurity D (CAS: 661463-79-2) typically synthesized?

Lamotrigine EP Impurity D (CAS: 661463-79-2) is synthesized through a series of reactions involving ...

Compound Q&A

What industries use Lamotrigine EP Impurity D (CAS: 661463-79-2)?

Lamotrigine EP Impurity D (CAS: 661463-79-2) is primarily used in the pharmaceutical industry, where...

Compound Q&A

What precautions should be taken when handling Lamotrigine EP Impurity D (CAS: 661463-79-2)?

When handling Lamotrigine EP Impurity D (CAS: 661463-79-2), it is crucial to use appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...