Compound Q&A

What industries use Vipivotide tetraxetan (CAS: 1702967-37-0)?

Answer

Vipivotide tetraxetan
Vipivotide tetraxetan (CAS: 1702967-37-0) is primarily used in the pharmaceutical industry for the development of innovative drug candidates. It is also explored in polymer science for its unique properties, and in biomedical research for its potential applications in diagnostic and therapeutic agents. Its stability and reactivity make it valuable in various scientific fields.

About

English Name Vipivotide tetraxetan
Molecular Formula C49H71N9O16
Molecular Weight 1042.14 g/mol
SMILES O=C(CN1CCN(CCN(CCN(CC1)CC(=O)O)CC(=O)O)CC(=O)O)NC[C@@H]1CC[C@H](CC1)C(=O)N[C@H](C(=O)NCCCC[C@@H](C(=O)O)NC(=O)N[C@H](C(=O)O)CCC(=O)O)Cc1ccc2c(c1)cccc2
InChIKey JBHPLHATEXGMQR-LFWIOBPJSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of Vipivotide tetraxetan (CAS: 1702967-37-0)?

Vipivotide tetraxetan (CAS: 1702967-37-0) is a crystalline compound with a molecular weight of appro...

Compound Q&A

How is Vipivotide tetraxetan (CAS: 1702967-37-0) typically synthesized?

Vipivotide tetraxetan (CAS: 1702967-37-0) is typically synthesized through a multistep process invol...

Compound Q&A

What precautions should be taken when handling Vipivotide tetraxetan (CAS: 1702967-37-0)?

When handling Vipivotide tetraxetan (CAS: 1702967-37-0), it is important to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...