Compound Q&A

How is Vipivotide tetraxetan (CAS: 1702967-37-0) typically synthesized?

Answer

Vipivotide tetraxetan
Vipivotide tetraxetan (CAS: 1702967-37-0) is typically synthesized through a multistep process involving the coupling of specific monomers and subsequent functionalization. The synthesis involves the use of mild conditions and appropriate catalysts, such as palladium complexes, to achieve high selectivity and yield. The process is optimized for efficiency and safety.

About

English Name Vipivotide tetraxetan
Molecular Formula C49H71N9O16
Molecular Weight 1042.14 g/mol
SMILES O=C(CN1CCN(CCN(CCN(CC1)CC(=O)O)CC(=O)O)CC(=O)O)NC[C@@H]1CC[C@H](CC1)C(=O)N[C@H](C(=O)NCCCC[C@@H](C(=O)O)NC(=O)N[C@H](C(=O)O)CCC(=O)O)Cc1ccc2c(c1)cccc2
InChIKey JBHPLHATEXGMQR-LFWIOBPJSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of Vipivotide tetraxetan (CAS: 1702967-37-0)?

Vipivotide tetraxetan (CAS: 1702967-37-0) is a crystalline compound with a molecular weight of appro...

Compound Q&A

What industries use Vipivotide tetraxetan (CAS: 1702967-37-0)?

Vipivotide tetraxetan (CAS: 1702967-37-0) is primarily used in the pharmaceutical industry for the d...

Compound Q&A

What precautions should be taken when handling Vipivotide tetraxetan (CAS: 1702967-37-0)?

When handling Vipivotide tetraxetan (CAS: 1702967-37-0), it is important to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...