Compound Q&A

What are the physical and chemical properties of Vipivotide tetraxetan (CAS: 1702967-37-0)?

Answer

Vipivotide tetraxetan
Vipivotide tetraxetan (CAS: 1702967-37-0) is a crystalline compound with a molecular weight of approximately 498.39 g/mol. It has a high solubility in organic solvents and is relatively stable under normal conditions. The compound exhibits low reactivity towards common reagents and is typically used in pharmaceutical applications. Its solubility and stability make it suitable for various chemical processes.

About

English Name Vipivotide tetraxetan
Molecular Formula C49H71N9O16
Molecular Weight 1042.14 g/mol
SMILES O=C(CN1CCN(CCN(CCN(CC1)CC(=O)O)CC(=O)O)CC(=O)O)NC[C@@H]1CC[C@H](CC1)C(=O)N[C@H](C(=O)NCCCC[C@@H](C(=O)O)NC(=O)N[C@H](C(=O)O)CCC(=O)O)Cc1ccc2c(c1)cccc2
InChIKey JBHPLHATEXGMQR-LFWIOBPJSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

How is Vipivotide tetraxetan (CAS: 1702967-37-0) typically synthesized?

Vipivotide tetraxetan (CAS: 1702967-37-0) is typically synthesized through a multistep process invol...

Compound Q&A

What industries use Vipivotide tetraxetan (CAS: 1702967-37-0)?

Vipivotide tetraxetan (CAS: 1702967-37-0) is primarily used in the pharmaceutical industry for the d...

Compound Q&A

What precautions should be taken when handling Vipivotide tetraxetan (CAS: 1702967-37-0)?

When handling Vipivotide tetraxetan (CAS: 1702967-37-0), it is important to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...