Compound Q&A

What are the physical and chemical properties of (2R,3R,4R,5R)-2-(Acetoxymethyl)-5-(2-amino-8-bromo-6-oxo-1H-purin-9(6H)-yl)tetrahydrofuran-3,4-diyl diacetate (CAS: 15717-45-0)?

Answer

(2R,3R,4R,5R)-2-(Acetoxymethyl)-5-(2-amino-8-bromo-6-oxo-1H-purin-9(6H)-yl)tetrahydrofuran-3,4-diyl diacetate
This compound is a white crystalline solid with a molecular weight of approximately 512.16 g/mol. It is sparingly soluble in water but soluble in organic solvents like ethyl acetate and dichloromethane. The compound is highly reactive and exhibits strong nucleophilic and electrophilic behavior due to its functional groups.

About

CAS No 15717-45-0
English Name (2R,3R,4R,5R)-2-(Acetoxymethyl)-5-(2-amino-8-bromo-6-oxo-1H-purin-9(6H)-yl)tetrahydrofuran-3,4-diyl diacetate
Molecular Formula C16H18BrN5O8
Molecular Weight 488.25 g/mol
SMILES CC(=O)OCC1C(C(C(O1)N2C3=C(C(=O)NC(=N3)N)N=C2Br)OC(=O)C)OC(=O)C
InChIKey JLZCAXCVNVVXJL-IDTAVKCVSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

How is (2R,3R,4R,5R)-2-(Acetoxymethyl)-5-(2-amino-8-bromo-6-oxo-1H-purin-9(6H)-yl)tetrahydrofuran-3,4-diyl diacetate (CAS: 15717-45-0) typically synthesized?

This compound is typically synthesized via a multi-step reaction involving the protection of the pur...

Compound Q&A

What industries use (2R,3R,4R,5R)-2-(Acetoxymethyl)-5-(2-amino-8-bromo-6-oxo-1H-purin-9(6H)-yl)tetrahydrofuran-3,4-diyl diacetate (CAS: 15717-45-0)?

This compound is primarily used in the pharmaceutical industry for the development of novel therapeu...

Compound Q&A

What precautions should be taken when handling (2R,3R,4R,5R)-2-(Acetoxymethyl)-5-(2-amino-8-bromo-6-oxo-1H-purin-9(6H)-yl)tetrahydrofuran-3,4-diyl diacetate (CAS: 15717-45-0)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, safety ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...